diff --git a/components/report_cards/chemical_probe/ControlStructuresAndUse.vue b/components/report_cards/chemical_probe/ControlStructuresAndUse.vue index 5a237bf8a686fb2bb7c3245041b765632989236c..e760d0713123844a195a55d999994ff3bebb1c91 100644 --- a/components/report_cards/chemical_probe/ControlStructuresAndUse.vue +++ b/components/report_cards/chemical_probe/ControlStructuresAndUse.vue @@ -20,6 +20,19 @@ text="Oc1ccc(CCc2ccc(O)c(O)c2)cc1O" title="smiles" /> + <TextToClipboard + text="YNSCZVGCGAWBBE-UHFFFAOYSA-M" + title="InChI Key" + /> + <div><b>Molecular weight:</b> 357.26</div> + <div> + <b>Storage:</b> + As a dry powder or as DMSO stock solutions (10mM) at -20 °C + </div> + <div> + <b>Dissolution:</b> + Soluble in DMSO up to 10mM + </div> </v-card-text> </v-card> </v-col> @@ -36,6 +49,25 @@ >CHEMBL1269459</a > </v-card-subtitle> + <v-card-text> + <TextToClipboard + text="Oc1ccc(CCc2ccc(O)c(O)c2)cc1O" + title="smiles" + /> + <TextToClipboard + text="FYULQBSQDOYPJQ-UHFFFAOYSA-N" + title="InChI Key" + /> + <div><b>Molecular weight:</b> 246.26</div> + <div> + <b>Storage:</b> + As a dry powder or as DMSO stock solutions (10mM) at -20 °C + </div> + <div> + <b>Dissolution:</b> + Soluble in DMSO up to 10mM + </div> + </v-card-text> </v-card> </v-col> </v-row> diff --git a/store/notification.js b/store/notification.js new file mode 100644 index 0000000000000000000000000000000000000000..53927cdc5f320ed5181e8cb4917f3b20676fcb00 --- /dev/null +++ b/store/notification.js @@ -0,0 +1,3 @@ +import notification from '~/web-components-submodule/store/notification.js' + +export default notification